C23H24BF3O4S — CID 162608823
1-[2-oxo-3-[4-pentyl-2-(trifluoromethyl)phenyl]-7-sulfanylchromen-8-yl]ethylboronic acid (PubChem CID 162608823) has the molecular formula C23H24BF3O4S and a molecular weight of 464.31 g/mol. Its IUPAC name is 1-[2-oxo-3-[4-pentyl-2-(trifluoromethyl)phenyl]-7-sulfanylchromen-8-yl]ethylboronic acid.
| Compound Name | 1-[2-oxo-3-[4-pentyl-2-(trifluoromethyl)phenyl]-7-sulfanylchromen-8-yl]ethylboronic acid |
|---|---|
| PubChem CID | 162608823 |
| Molecular Formula | C23H24BF3O4S |
| Molecular Weight | 464.31 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | 1-[2-oxo-3-[4-pentyl-2-(trifluoromethyl)phenyl]-7-sulfanylchromen-8-yl]ethylboronic acid |
| SMILES | CCCCCc1ccc(-c2cc3ccc(S)c(C(C)B(O)O)c3oc2=O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H24BF3O4S/c1-3-4-5-6-14-7-9-16(18(11-14)23(25,26)27)17-12-15-8-10-19(32)20(13(2)24(29)30)21(15)31-22(17)28/h7-13,29-30,32H,3-6H2,1-2H3 |
| InChIKey | SSBRSSQBUIDFAE-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.31 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|