C17H26O2 — CID 142678963
4-(3,4-dimethylphenyl)butyl 2,2-dimethylpropanoate (PubChem CID 142678963) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is 4-(3,4-dimethylphenyl)butyl 2,2-dimethylpropanoate.
| Compound Name | 4-(3,4-dimethylphenyl)butyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 142678963 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | 4-(3,4-dimethylphenyl)butyl 2,2-dimethylpropanoate |
| SMILES | Cc1ccc(CCCCOC(=O)C(C)(C)C)cc1C |
| InChI | InChI=1S/C17H26O2/c1-13-9-10-15(12-14(13)2)8-6-7-11-19-16(18)17(3,4)5/h9-10,12H,6-8,11H2,1-5H3 |
| InChIKey | OQZUCUXDUGSXHV-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|