C33H45NO5 — CID 162356920
8-(2-oxo-3-phenylpyrano[2,3-b]pyridin-7-yl)oxyoctyl 2,2,3,5,5-pentamethylhexanoate (PubChem CID 162356920) has the molecular formula C33H45NO5 and a molecular weight of 535.73 g/mol. Its IUPAC name is 8-(2-oxo-3-phenylpyrano[2,3-b]pyridin-7-yl)oxyoctyl 2,2,3,5,5-pentamethylhexanoate.
| Compound Name | 8-(2-oxo-3-phenylpyrano[2,3-b]pyridin-7-yl)oxyoctyl 2,2,3,5,5-pentamethylhexanoate |
|---|---|
| PubChem CID | 162356920 |
| Molecular Formula | C33H45NO5 |
| Molecular Weight | 535.73 g/mol |
| Exact Mass | 535.33 |
| IUPAC Name | 8-(2-oxo-3-phenylpyrano[2,3-b]pyridin-7-yl)oxyoctyl 2,2,3,5,5-pentamethylhexanoate |
| SMILES | CC(CC(C)(C)C)C(C)(C)C(=O)OCCCCCCCCOc1ccc2cc(-c3ccccc3)c(=O)oc2n1 |
| InChI | InChI=1S/C33H45NO5/c1-24(23-32(2,3)4)33(5,6)31(36)38-21-15-10-8-7-9-14-20-37-28-19-18-26-22-27(25-16-12-11-13-17-25)30(35)39-29(26)34-28/h11-13,16-19,22,24H,7-10,14-15,20-21,23H2,1-6H3 |
| InChIKey | VUSOARVPYMOMKI-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.73 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|