About 3-(3,5-difluorophenyl)-7-(10-ethoxydecoxy)pyrano[2,3-b]pyridin-2-one
3-(3,5-difluorophenyl)-7-(10-ethoxydecoxy)pyrano[2,3-b]pyridin-2-one (PubChem CID 168824149) has the molecular formula C26H31F2NO4
and a molecular weight of 459.53 g/mol. Its IUPAC name is 3-(3,5-difluorophenyl)-7-(10-ethoxydecoxy)pyrano[2,3-b]pyridin-2-one.
Molecular Properties
| Compound Name | 3-(3,5-difluorophenyl)-7-(10-ethoxydecoxy)pyrano[2,3-b]pyridin-2-one |
| PubChem CID | 168824149 |
| Molecular Formula | C26H31F2NO4 |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | 3-(3,5-difluorophenyl)-7-(10-ethoxydecoxy)pyrano[2,3-b]pyridin-2-one |
| SMILES | CCOCCCCCCCCCCOc1ccc2cc(-c3cc(F)cc(F)c3)c(=O)oc2n1 |
| InChI | InChI=1S/C26H31F2NO4/c1-2-31-13-9-7-5-3-4-6-8-10-14-32-24-12-11-19-17-23(26(30)33-25(19)29-24)20-15-21(27)18-22(28)16-20/h11-12,15-18H,2-10,13-14H2,1H3 |
| InChIKey | GLJSBRNSHDCDIB-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,5-difluorophenyl)-7-(10-ethoxydecoxy)pyrano[2,3-b]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-difluorophenyl)-7-(10-ethoxydecoxy)pyrano[2,3-b]pyridin-2-one?
The IUPAC name of 3-(3,5-difluorophenyl)-7-(10-ethoxydecoxy)pyrano[2,3-b]pyridin-2-one (CID 168824149) is 3-(3,5-difluorophenyl)-7-(10-ethoxydecoxy)pyrano[2,3-b]pyridin-2-one.
What is the SMILES notation for 3-(3,5-difluorophenyl)-7-(10-ethoxydecoxy)pyrano[2,3-b]pyridin-2-one?
The canonical SMILES for 3-(3,5-difluorophenyl)-7-(10-ethoxydecoxy)pyrano[2,3-b]pyridin-2-one is CCOCCCCCCCCCCOc1ccc2cc(-c3cc(F)cc(F)c3)c(=O)oc2n1.
What is the InChIKey of 3-(3,5-difluorophenyl)-7-(10-ethoxydecoxy)pyrano[2,3-b]pyridin-2-one?
The InChIKey is GLJSBRNSHDCDIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H31F2NO4/c1-2-31-13-9-7-5-3-4-6-8-10-14-32-24-12-11-19-17-23(26(30)33-25(19)29-24)20-15-21(27)18-22(28)16-20/h11-12,15-18H,2-10,13-14H2,1H3.
What are the key properties of 3-(3,5-difluorophenyl)-7-(10-ethoxydecoxy)pyrano[2,3-b]pyridin-2-one?
3-(3,5-difluorophenyl)-7-(10-ethoxydecoxy)pyrano[2,3-b]pyridin-2-one has a molecular weight of 459.53 g/mol, XLogP of 6.67, 14 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-difluorophenyl)-7-(10-ethoxydecoxy)pyrano[2,3-b]pyridin-2-one is sourced from PubChem (CID 168824149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).