C23H27NO7 — CID 162356734
3-[4-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]phenyl]pyrano[2,3-b]pyridin-2-one (PubChem CID 162356734) has the molecular formula C23H27NO7 and a molecular weight of 429.47 g/mol. Its IUPAC name is 3-[4-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]phenyl]pyrano[2,3-b]pyridin-2-one.
| Compound Name | 3-[4-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]phenyl]pyrano[2,3-b]pyridin-2-one |
|---|---|
| PubChem CID | 162356734 |
| Molecular Formula | C23H27NO7 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | 3-[4-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]phenyl]pyrano[2,3-b]pyridin-2-one |
| SMILES | COCCOCCOCCOCCOc1ccc(-c2cc3cccnc3oc2=O)cc1 |
| InChI | InChI=1S/C23H27NO7/c1-26-9-10-27-11-12-28-13-14-29-15-16-30-20-6-4-18(5-7-20)21-17-19-3-2-8-24-22(19)31-23(21)25/h2-8,17H,9-16H2,1H3 |
| InChIKey | PBNQBSBGGXQBPQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 89.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|