C36H48N2O10S — CID 166983283
4,7-bis[4-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]phenyl]-2,1,3-benzothiadiazole (PubChem CID 166983283) has the molecular formula C36H48N2O10S and a molecular weight of 700.85 g/mol. Its IUPAC name is 4,7-bis[4-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]phenyl]-2,1,3-benzothiadiazole.
| Compound Name | 4,7-bis[4-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]phenyl]-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 166983283 |
| Molecular Formula | C36H48N2O10S |
| Molecular Weight | 700.85 g/mol |
| Exact Mass | 700.30 |
| IUPAC Name | 4,7-bis[4-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]phenyl]-2,1,3-benzothiadiazole |
| SMILES | COCCOCCOCCOCCOc1ccc(-c2ccc(-c3ccc(OCCOCCOCCOCCOC)cc3)c3nsnc23)cc1 |
| InChI | InChI=1S/C36H48N2O10S/c1-39-13-15-41-17-19-43-21-23-45-25-27-47-31-7-3-29(4-8-31)33-11-12-34(36-35(33)37-49-38-36)30-5-9-32(10-6-30)48-28-26-46-24-22-44-20-18-42-16-14-40-2/h3-12H,13-28H2,1-2H3 |
| InChIKey | GGUMLKZBCYRGLU-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 118.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.85 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|