C19H18N2O3S3 — CID 118150181
4-[5-[2-(2-methoxyethoxy)ethoxy]thiophen-2-yl]-7-thiophen-2-yl-2,1,3-benzothiadiazole (PubChem CID 118150181) has the molecular formula C19H18N2O3S3 and a molecular weight of 418.57 g/mol. Its IUPAC name is 4-[5-[2-(2-methoxyethoxy)ethoxy]thiophen-2-yl]-7-thiophen-2-yl-2,1,3-benzothiadiazole.
| Compound Name | 4-[5-[2-(2-methoxyethoxy)ethoxy]thiophen-2-yl]-7-thiophen-2-yl-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 118150181 |
| Molecular Formula | C19H18N2O3S3 |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | 4-[5-[2-(2-methoxyethoxy)ethoxy]thiophen-2-yl]-7-thiophen-2-yl-2,1,3-benzothiadiazole |
| SMILES | COCCOCCOc1ccc(-c2ccc(-c3cccs3)c3nsnc23)s1 |
| InChI | InChI=1S/C19H18N2O3S3/c1-22-8-9-23-10-11-24-17-7-6-16(26-17)14-5-4-13(15-3-2-12-25-15)18-19(14)21-27-20-18/h2-7,12H,8-11H2,1H3 |
| InChIKey | JJQNYLIQJMEVHE-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|