C26H18N2S4 — CID 101404191
2,3-dimethyl-5,8-bis(5-thiophen-2-ylthiophen-2-yl)quinoxaline (PubChem CID 101404191) has the molecular formula C26H18N2S4 and a molecular weight of 486.71 g/mol. Its IUPAC name is 2,3-dimethyl-5,8-bis(5-thiophen-2-ylthiophen-2-yl)quinoxaline.
| Compound Name | 2,3-dimethyl-5,8-bis(5-thiophen-2-ylthiophen-2-yl)quinoxaline |
|---|---|
| PubChem CID | 101404191 |
| Molecular Formula | C26H18N2S4 |
| Molecular Weight | 486.71 g/mol |
| Exact Mass | 486.04 |
| IUPAC Name | 2,3-dimethyl-5,8-bis(5-thiophen-2-ylthiophen-2-yl)quinoxaline |
| SMILES | Cc1nc2c(-c3ccc(-c4cccs4)s3)ccc(-c3ccc(-c4cccs4)s3)c2nc1C |
| InChI | InChI=1S/C26H18N2S4/c1-15-16(2)28-26-18(20-10-12-24(32-20)22-6-4-14-30-22)8-7-17(25(26)27-15)19-9-11-23(31-19)21-5-3-13-29-21/h3-14H,1-2H3 |
| InChIKey | CMXCNIMIQVWHKB-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.71 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |