C20H12N2S4 — CID 59488709
2,6-bis(5-thiophen-2-ylthiophen-2-yl)pyrazine (PubChem CID 59488709) has the molecular formula C20H12N2S4 and a molecular weight of 408.60 g/mol. Its IUPAC name is 2,6-bis(5-thiophen-2-ylthiophen-2-yl)pyrazine.
| Compound Name | 2,6-bis(5-thiophen-2-ylthiophen-2-yl)pyrazine |
|---|---|
| PubChem CID | 59488709 |
| Molecular Formula | C20H12N2S4 |
| Molecular Weight | 408.60 g/mol |
| Exact Mass | 407.99 |
| IUPAC Name | 2,6-bis(5-thiophen-2-ylthiophen-2-yl)pyrazine |
| SMILES | c1csc(-c2ccc(-c3cncc(-c4ccc(-c5cccs5)s4)n3)s2)c1 |
| InChI | InChI=1S/C20H12N2S4/c1-3-17(23-9-1)19-7-5-15(25-19)13-11-21-12-14(22-13)16-6-8-20(26-16)18-4-2-10-24-18/h1-12H |
| InChIKey | WLBVQWFXWIRVPN-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.60 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |