C11H7NOS2 — CID 2739851
3-(5-thiophen-2-ylthiophen-2-yl)-1,2-oxazole (PubChem CID 2739851) has the molecular formula C11H7NOS2 and a molecular weight of 233.32 g/mol. Its IUPAC name is 3-(5-thiophen-2-ylthiophen-2-yl)-1,2-oxazole.
| Compound Name | 3-(5-thiophen-2-ylthiophen-2-yl)-1,2-oxazole |
|---|---|
| PubChem CID | 2739851 |
| Molecular Formula | C11H7NOS2 |
| Molecular Weight | 233.32 g/mol |
| Exact Mass | 233.00 |
| IUPAC Name | 3-(5-thiophen-2-ylthiophen-2-yl)-1,2-oxazole |
| SMILES | c1csc(-c2ccc(-c3ccon3)s2)c1 |
| InChI | InChI=1S/C11H7NOS2/c1-2-10(14-7-1)11-4-3-9(15-11)8-5-6-13-12-8/h1-7H |
| InChIKey | NPTGCTNNEATAHQ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.32 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |