C7H5Cl2NO3S2 — CID 160888974
sulfuryl dichloride;3-thiophen-2-yl-1,2-oxazole (PubChem CID 160888974) has the molecular formula C7H5Cl2NO3S2 and a molecular weight of 286.16 g/mol. Its IUPAC name is sulfuryl dichloride;3-thiophen-2-yl-1,2-oxazole.
| Compound Name | sulfuryl dichloride;3-thiophen-2-yl-1,2-oxazole |
|---|---|
| PubChem CID | 160888974 |
| Molecular Formula | C7H5Cl2NO3S2 |
| Molecular Weight | 286.16 g/mol |
| Exact Mass | 284.91 |
| IUPAC Name | sulfuryl dichloride;3-thiophen-2-yl-1,2-oxazole |
| SMILES | O=S(=O)(Cl)Cl.c1csc(-c2ccon2)c1 |
| InChI | InChI=1S/C7H5NOS.Cl2O2S/c1-2-7(10-5-1)6-3-4-9-8-6;1-5(2,3)4/h1-5H; |
| InChIKey | SNZWGFDXNALSKL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.16 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |