C8H5F2NOS — CID 102110954
5-(difluoromethyl)-3-thiophen-2-yl-1,2-oxazole (PubChem CID 102110954) has the molecular formula C8H5F2NOS and a molecular weight of 201.20 g/mol. Its IUPAC name is 5-(difluoromethyl)-3-thiophen-2-yl-1,2-oxazole.
| Compound Name | 5-(difluoromethyl)-3-thiophen-2-yl-1,2-oxazole |
|---|---|
| PubChem CID | 102110954 |
| Molecular Formula | C8H5F2NOS |
| Molecular Weight | 201.20 g/mol |
| Exact Mass | 201.01 |
| IUPAC Name | 5-(difluoromethyl)-3-thiophen-2-yl-1,2-oxazole |
| SMILES | FC(F)c1cc(-c2cccs2)no1 |
| InChI | InChI=1S/C8H5F2NOS/c9-8(10)6-4-5(11-12-6)7-2-1-3-13-7/h1-4,8H |
| InChIKey | XRNMYGSEGYYDMY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.20 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |