C13H8FNOS — CID 99964161
5-(2-fluorophenyl)-3-thiophen-2-yl-1,2-oxazole (PubChem CID 99964161) has the molecular formula C13H8FNOS and a molecular weight of 245.28 g/mol. Its IUPAC name is 5-(2-fluorophenyl)-3-thiophen-2-yl-1,2-oxazole.
| Compound Name | 5-(2-fluorophenyl)-3-thiophen-2-yl-1,2-oxazole |
|---|---|
| PubChem CID | 99964161 |
| Molecular Formula | C13H8FNOS |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.03 |
| IUPAC Name | 5-(2-fluorophenyl)-3-thiophen-2-yl-1,2-oxazole |
| SMILES | Fc1ccccc1-c1cc(-c2cccs2)no1 |
| InChI | InChI=1S/C13H8FNOS/c14-10-5-2-1-4-9(10)12-8-11(15-16-12)13-6-3-7-17-13/h1-8H |
| InChIKey | DEKTUAAFMNGLJK-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |