C8H6N2O2S — CID 776505
3-thiophen-2-yl-1,2-oxazole-5-carboxamide (PubChem CID 776505) has the molecular formula C8H6N2O2S and a molecular weight of 194.22 g/mol. Its IUPAC name is 3-thiophen-2-yl-1,2-oxazole-5-carboxamide.
| Compound Name | 3-thiophen-2-yl-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 776505 |
| Molecular Formula | C8H6N2O2S |
| Molecular Weight | 194.22 g/mol |
| Exact Mass | 194.01 |
| IUPAC Name | 3-thiophen-2-yl-1,2-oxazole-5-carboxamide |
| SMILES | NC(=O)c1cc(-c2cccs2)no1 |
| InChI | InChI=1S/C8H6N2O2S/c9-8(11)6-4-5(10-12-6)7-2-1-3-13-7/h1-4H,(H2,9,11) |
| InChIKey | GQXQNFMDEKWHQO-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.22 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |