C11H8N2O4 — CID 3146119
3-(1,3-benzodioxol-5-yl)-1,2-oxazole-5-carboxamide (PubChem CID 3146119) has the molecular formula C11H8N2O4 and a molecular weight of 232.19 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-1,2-oxazole-5-carboxamide.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 3146119 |
| Molecular Formula | C11H8N2O4 |
| Molecular Weight | 232.19 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-1,2-oxazole-5-carboxamide |
| SMILES | NC(=O)c1cc(-c2ccc3c(c2)OCO3)no1 |
| InChI | InChI=1S/C11H8N2O4/c12-11(14)10-4-7(13-17-10)6-1-2-8-9(3-6)16-5-15-8/h1-4H,5H2,(H2,12,14) |
| InChIKey | OGZSBMJSVNFNOP-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.19 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |