C7H5N3OS2 — CID 11367830
4-thiophen-2-yl-1,2,5-thiadiazole-3-carboxamide (PubChem CID 11367830) has the molecular formula C7H5N3OS2 and a molecular weight of 211.27 g/mol. Its IUPAC name is 4-thiophen-2-yl-1,2,5-thiadiazole-3-carboxamide.
| Compound Name | 4-thiophen-2-yl-1,2,5-thiadiazole-3-carboxamide |
|---|---|
| PubChem CID | 11367830 |
| Molecular Formula | C7H5N3OS2 |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 210.99 |
| IUPAC Name | 4-thiophen-2-yl-1,2,5-thiadiazole-3-carboxamide |
| SMILES | NC(=O)c1nsnc1-c1cccs1 |
| InChI | InChI=1S/C7H5N3OS2/c8-7(11)6-5(9-13-10-6)4-2-1-3-12-4/h1-3H,(H2,8,11) |
| InChIKey | AGNZWZJLWUDCBL-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |