C9H6FN3OS — CID 11322035
4-(4-fluorophenyl)-1,2,5-thiadiazole-3-carboxamide (PubChem CID 11322035) has the molecular formula C9H6FN3OS and a molecular weight of 223.23 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-1,2,5-thiadiazole-3-carboxamide.
| Compound Name | 4-(4-fluorophenyl)-1,2,5-thiadiazole-3-carboxamide |
|---|---|
| PubChem CID | 11322035 |
| Molecular Formula | C9H6FN3OS |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.02 |
| IUPAC Name | 4-(4-fluorophenyl)-1,2,5-thiadiazole-3-carboxamide |
| SMILES | NC(=O)c1nsnc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C9H6FN3OS/c10-6-3-1-5(2-4-6)7-8(9(11)14)13-15-12-7/h1-4H,(H2,11,14) |
| InChIKey | RMJLKEGGLXCAEY-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |