C11H9FN2O3S — CID 140649788
5-(4-fluorophenyl)-2-methylsulfinyl-1,3-oxazole-4-carboxamide (PubChem CID 140649788) has the molecular formula C11H9FN2O3S and a molecular weight of 268.27 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-2-methylsulfinyl-1,3-oxazole-4-carboxamide.
| Compound Name | 5-(4-fluorophenyl)-2-methylsulfinyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 140649788 |
| Molecular Formula | C11H9FN2O3S |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 5-(4-fluorophenyl)-2-methylsulfinyl-1,3-oxazole-4-carboxamide |
| SMILES | CS(=O)c1nc(C(N)=O)c(-c2ccc(F)cc2)o1 |
| InChI | InChI=1S/C11H9FN2O3S/c1-18(16)11-14-8(10(13)15)9(17-11)6-2-4-7(12)5-3-6/h2-5H,1H3,(H2,13,15) |
| InChIKey | YRAVTNIFDHTSEY-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |