C18H15F2N3O3 — CID 91386099
2-(2,6-difluorophenyl)-5-[4-(1-hydroxyethylamino)phenyl]-1,3-oxazole-4-carboxamide (PubChem CID 91386099) has the molecular formula C18H15F2N3O3 and a molecular weight of 359.33 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-5-[4-(1-hydroxyethylamino)phenyl]-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(2,6-difluorophenyl)-5-[4-(1-hydroxyethylamino)phenyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 91386099 |
| Molecular Formula | C18H15F2N3O3 |
| Molecular Weight | 359.33 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 2-(2,6-difluorophenyl)-5-[4-(1-hydroxyethylamino)phenyl]-1,3-oxazole-4-carboxamide |
| SMILES | CC(O)Nc1ccc(-c2oc(-c3c(F)cccc3F)nc2C(N)=O)cc1 |
| InChI | InChI=1S/C18H15F2N3O3/c1-9(24)22-11-7-5-10(6-8-11)16-15(17(21)25)23-18(26-16)14-12(19)3-2-4-13(14)20/h2-9,22,24H,1H3,(H2,21,25) |
| InChIKey | ZZEVDBGVNUVQPL-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|