C16H12FN2O2P — CID 143993495
2-(2-fluoro-6-phosphanylphenyl)-5-phenyl-1,3-oxazole-4-carboxamide (PubChem CID 143993495) has the molecular formula C16H12FN2O2P and a molecular weight of 314.26 g/mol. Its IUPAC name is 2-(2-fluoro-6-phosphanylphenyl)-5-phenyl-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(2-fluoro-6-phosphanylphenyl)-5-phenyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 143993495 |
| Molecular Formula | C16H12FN2O2P |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 2-(2-fluoro-6-phosphanylphenyl)-5-phenyl-1,3-oxazole-4-carboxamide |
| SMILES | NC(=O)c1nc(-c2c(F)cccc2P)oc1-c1ccccc1 |
| InChI | InChI=1S/C16H12FN2O2P/c17-10-7-4-8-11(22)12(10)16-19-13(15(18)20)14(21-16)9-5-2-1-3-6-9/h1-8H,22H2,(H2,18,20) |
| InChIKey | SCOAMGBBADIOFN-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|