C18H13F2N3O4 — CID 90813230
5-[(1,3-benzodioxol-5-ylamino)methyl]-2-(2,6-difluorophenyl)-1,3-oxazole-4-carboxamide (PubChem CID 90813230) has the molecular formula C18H13F2N3O4 and a molecular weight of 373.32 g/mol. Its IUPAC name is 5-[(1,3-benzodioxol-5-ylamino)methyl]-2-(2,6-difluorophenyl)-1,3-oxazole-4-carboxamide.
| Compound Name | 5-[(1,3-benzodioxol-5-ylamino)methyl]-2-(2,6-difluorophenyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 90813230 |
| Molecular Formula | C18H13F2N3O4 |
| Molecular Weight | 373.32 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | 5-[(1,3-benzodioxol-5-ylamino)methyl]-2-(2,6-difluorophenyl)-1,3-oxazole-4-carboxamide |
| SMILES | NC(=O)c1nc(-c2c(F)cccc2F)oc1CNc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H13F2N3O4/c19-10-2-1-3-11(20)15(10)18-23-16(17(21)24)14(27-18)7-22-9-4-5-12-13(6-9)26-8-25-12/h1-6,22H,7-8H2,(H2,21,24) |
| InChIKey | PKFMTUGYKRDRGU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|