C14H11F2NO3 — CID 79886832
4-[(1,3-benzodioxol-5-ylamino)methyl]-2,6-difluorophenol (PubChem CID 79886832) has the molecular formula C14H11F2NO3 and a molecular weight of 279.24 g/mol. Its IUPAC name is 4-[(1,3-benzodioxol-5-ylamino)methyl]-2,6-difluorophenol.
| Compound Name | 4-[(1,3-benzodioxol-5-ylamino)methyl]-2,6-difluorophenol |
|---|---|
| PubChem CID | 79886832 |
| Molecular Formula | C14H11F2NO3 |
| Molecular Weight | 279.24 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 4-[(1,3-benzodioxol-5-ylamino)methyl]-2,6-difluorophenol |
| SMILES | Oc1c(F)cc(CNc2ccc3c(c2)OCO3)cc1F |
| InChI | InChI=1S/C14H11F2NO3/c15-10-3-8(4-11(16)14(10)18)6-17-9-1-2-12-13(5-9)20-7-19-12/h1-5,17-18H,6-7H2 |
| InChIKey | VIQXIESKAOBDIF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.24 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|