C17H19NO3 — CID 28619903
N-[(4-propoxyphenyl)methyl]-1,3-benzodioxol-5-amine (PubChem CID 28619903) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is N-[(4-propoxyphenyl)methyl]-1,3-benzodioxol-5-amine.
| Compound Name | N-[(4-propoxyphenyl)methyl]-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 28619903 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | N-[(4-propoxyphenyl)methyl]-1,3-benzodioxol-5-amine |
| SMILES | CCCOc1ccc(CNc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C17H19NO3/c1-2-9-19-15-6-3-13(4-7-15)11-18-14-5-8-16-17(10-14)21-12-20-16/h3-8,10,18H,2,9,11-12H2,1H3 |
| InChIKey | XCKNWJUNUKQZBT-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|