C17H19NO4 — CID 39424104
N-[[4-(2-methoxyethoxy)phenyl]methyl]-1,3-benzodioxol-5-amine (PubChem CID 39424104) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is N-[[4-(2-methoxyethoxy)phenyl]methyl]-1,3-benzodioxol-5-amine.
| Compound Name | N-[[4-(2-methoxyethoxy)phenyl]methyl]-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 39424104 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | N-[[4-(2-methoxyethoxy)phenyl]methyl]-1,3-benzodioxol-5-amine |
| SMILES | COCCOc1ccc(CNc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C17H19NO4/c1-19-8-9-20-15-5-2-13(3-6-15)11-18-14-4-7-16-17(10-14)22-12-21-16/h2-7,10,18H,8-9,11-12H2,1H3 |
| InChIKey | VWQWGTXFSRZHRM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|