C19H20O4 — CID 53415848
1-(1,3-benzodioxol-5-yl)-3-(4-propoxyphenyl)propan-1-one (PubChem CID 53415848) has the molecular formula C19H20O4 and a molecular weight of 312.37 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-(4-propoxyphenyl)propan-1-one.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-(4-propoxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 53415848 |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-(4-propoxyphenyl)propan-1-one |
| SMILES | CCCOc1ccc(CCC(=O)c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C19H20O4/c1-2-11-21-16-7-3-14(4-8-16)5-9-17(20)15-6-10-18-19(12-15)23-13-22-18/h3-4,6-8,10,12H,2,5,9,11,13H2,1H3 |
| InChIKey | LZFPOICGBHGZCA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |