C15H15ClFNO2 — CID 122129534
N-[2-(4-fluorophenyl)ethyl]-1,3-benzodioxol-5-amine;hydrochloride (PubChem CID 122129534) has the molecular formula C15H15ClFNO2 and a molecular weight of 295.74 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)ethyl]-1,3-benzodioxol-5-amine;hydrochloride.
| Compound Name | N-[2-(4-fluorophenyl)ethyl]-1,3-benzodioxol-5-amine;hydrochloride |
|---|---|
| PubChem CID | 122129534 |
| Molecular Formula | C15H15ClFNO2 |
| Molecular Weight | 295.74 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | N-[2-(4-fluorophenyl)ethyl]-1,3-benzodioxol-5-amine;hydrochloride |
| SMILES | Cl.Fc1ccc(CCNc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C15H14FNO2.ClH/c16-12-3-1-11(2-4-12)7-8-17-13-5-6-14-15(9-13)19-10-18-14;/h1-6,9,17H,7-8,10H2;1H |
| InChIKey | FGNDULZFLZKZKN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.74 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|