C14H11ClFNO3 — CID 64782974
4-[(7-chloro-1,3-benzodioxol-5-yl)methylamino]-2-fluorophenol (PubChem CID 64782974) has the molecular formula C14H11ClFNO3 and a molecular weight of 295.70 g/mol. Its IUPAC name is 4-[(7-chloro-1,3-benzodioxol-5-yl)methylamino]-2-fluorophenol.
| Compound Name | 4-[(7-chloro-1,3-benzodioxol-5-yl)methylamino]-2-fluorophenol |
|---|---|
| PubChem CID | 64782974 |
| Molecular Formula | C14H11ClFNO3 |
| Molecular Weight | 295.70 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 4-[(7-chloro-1,3-benzodioxol-5-yl)methylamino]-2-fluorophenol |
| SMILES | Oc1ccc(NCc2cc(Cl)c3c(c2)OCO3)cc1F |
| InChI | InChI=1S/C14H11ClFNO3/c15-10-3-8(4-13-14(10)20-7-19-13)6-17-9-1-2-12(18)11(16)5-9/h1-5,17-18H,6-7H2 |
| InChIKey | KLYJBJSTAIPEAI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.70 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|