C14H9ClF3NO2 — CID 62809286
N-[(7-chloro-1,3-benzodioxol-5-yl)methyl]-2,3,5-trifluoroaniline (PubChem CID 62809286) has the molecular formula C14H9ClF3NO2 and a molecular weight of 315.68 g/mol. Its IUPAC name is N-[(7-chloro-1,3-benzodioxol-5-yl)methyl]-2,3,5-trifluoroaniline.
| Compound Name | N-[(7-chloro-1,3-benzodioxol-5-yl)methyl]-2,3,5-trifluoroaniline |
|---|---|
| PubChem CID | 62809286 |
| Molecular Formula | C14H9ClF3NO2 |
| Molecular Weight | 315.68 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | N-[(7-chloro-1,3-benzodioxol-5-yl)methyl]-2,3,5-trifluoroaniline |
| SMILES | Fc1cc(F)c(F)c(NCc2cc(Cl)c3c(c2)OCO3)c1 |
| InChI | InChI=1S/C14H9ClF3NO2/c15-9-1-7(2-12-14(9)21-6-20-12)5-19-11-4-8(16)3-10(17)13(11)18/h1-4,19H,5-6H2 |
| InChIKey | XAEDROVZIYENSY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.68 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|