C10H9FN2O — CID 114834344
5-(4-fluorophenyl)-4-methyl-1,3-oxazol-2-amine (PubChem CID 114834344) has the molecular formula C10H9FN2O and a molecular weight of 192.19 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-4-methyl-1,3-oxazol-2-amine.
| Compound Name | 5-(4-fluorophenyl)-4-methyl-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 114834344 |
| Molecular Formula | C10H9FN2O |
| Molecular Weight | 192.19 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 5-(4-fluorophenyl)-4-methyl-1,3-oxazol-2-amine |
| SMILES | Cc1nc(N)oc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C10H9FN2O/c1-6-9(14-10(12)13-6)7-2-4-8(11)5-3-7/h2-5H,1H3,(H2,12,13) |
| InChIKey | RITBFMKOTWBSPZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.19 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |