C15H16FN — CID 162298886
2-(4-fluorophenyl)-3,4,5,6-tetramethylpyridine (PubChem CID 162298886) has the molecular formula C15H16FN and a molecular weight of 229.30 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-3,4,5,6-tetramethylpyridine.
| Compound Name | 2-(4-fluorophenyl)-3,4,5,6-tetramethylpyridine |
|---|---|
| PubChem CID | 162298886 |
| Molecular Formula | C15H16FN |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | 2-(4-fluorophenyl)-3,4,5,6-tetramethylpyridine |
| SMILES | Cc1nc(-c2ccc(F)cc2)c(C)c(C)c1C |
| InChI | InChI=1S/C15H16FN/c1-9-10(2)12(4)17-15(11(9)3)13-5-7-14(16)8-6-13/h5-8H,1-4H3 |
| InChIKey | ZPRJGSXTRLVYHX-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |