C10H7FINO — CID 102974766
5-(3-fluorophenyl)-2-iodo-4-methyl-1,3-oxazole (PubChem CID 102974766) has the molecular formula C10H7FINO and a molecular weight of 303.07 g/mol. Its IUPAC name is 5-(3-fluorophenyl)-2-iodo-4-methyl-1,3-oxazole.
| Compound Name | 5-(3-fluorophenyl)-2-iodo-4-methyl-1,3-oxazole |
|---|---|
| PubChem CID | 102974766 |
| Molecular Formula | C10H7FINO |
| Molecular Weight | 303.07 g/mol |
| Exact Mass | 302.96 |
| IUPAC Name | 5-(3-fluorophenyl)-2-iodo-4-methyl-1,3-oxazole |
| SMILES | Cc1nc(I)oc1-c1cccc(F)c1 |
| InChI | InChI=1S/C10H7FINO/c1-6-9(14-10(12)13-6)7-3-2-4-8(11)5-7/h2-5H,1H3 |
| InChIKey | QDQLZAZIVSUMAI-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.07 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|