C11H9BrFNO — CID 114873250
3-(bromomethyl)-5-(3-fluorophenyl)-4-methyl-1,2-oxazole (PubChem CID 114873250) has the molecular formula C11H9BrFNO and a molecular weight of 270.10 g/mol. Its IUPAC name is 3-(bromomethyl)-5-(3-fluorophenyl)-4-methyl-1,2-oxazole.
| Compound Name | 3-(bromomethyl)-5-(3-fluorophenyl)-4-methyl-1,2-oxazole |
|---|---|
| PubChem CID | 114873250 |
| Molecular Formula | C11H9BrFNO |
| Molecular Weight | 270.10 g/mol |
| Exact Mass | 268.99 |
| IUPAC Name | 3-(bromomethyl)-5-(3-fluorophenyl)-4-methyl-1,2-oxazole |
| SMILES | Cc1c(CBr)noc1-c1cccc(F)c1 |
| InChI | InChI=1S/C11H9BrFNO/c1-7-10(6-12)14-15-11(7)8-3-2-4-9(13)5-8/h2-5H,6H2,1H3 |
| InChIKey | VQXGDFSULKRFMD-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.10 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|