C13H15FN2O — CID 65240105
N-[[5-(3-fluorophenyl)-1,2-oxazol-4-yl]methyl]propan-1-amine (PubChem CID 65240105) has the molecular formula C13H15FN2O and a molecular weight of 234.27 g/mol. Its IUPAC name is N-[[5-(3-fluorophenyl)-1,2-oxazol-4-yl]methyl]propan-1-amine.
| Compound Name | N-[[5-(3-fluorophenyl)-1,2-oxazol-4-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 65240105 |
| Molecular Formula | C13H15FN2O |
| Molecular Weight | 234.27 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | N-[[5-(3-fluorophenyl)-1,2-oxazol-4-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cnoc1-c1cccc(F)c1 |
| InChI | InChI=1S/C13H15FN2O/c1-2-6-15-8-11-9-16-17-13(11)10-4-3-5-12(14)7-10/h3-5,7,9,15H,2,6,8H2,1H3 |
| InChIKey | DDTCVIGNLBEFGA-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.27 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|