C17H18N2O — CID 65239480
N-[(5-naphthalen-1-yl-1,2-oxazol-4-yl)methyl]propan-1-amine (PubChem CID 65239480) has the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. Its IUPAC name is N-[(5-naphthalen-1-yl-1,2-oxazol-4-yl)methyl]propan-1-amine.
| Compound Name | N-[(5-naphthalen-1-yl-1,2-oxazol-4-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 65239480 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | N-[(5-naphthalen-1-yl-1,2-oxazol-4-yl)methyl]propan-1-amine |
| SMILES | CCCNCc1cnoc1-c1cccc2ccccc12 |
| InChI | InChI=1S/C17H18N2O/c1-2-10-18-11-14-12-19-20-17(14)16-9-5-7-13-6-3-4-8-15(13)16/h3-9,12,18H,2,10-11H2,1H3 |
| InChIKey | IJGFNRBNNARPES-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|