C20H17F2N3O3 — CID 167823701
N-[(3,5-difluorophenyl)methyl]-N'-[(4-methyl-5-phenyl-1,2-oxazol-3-yl)methyl]oxamide (PubChem CID 167823701) has the molecular formula C20H17F2N3O3 and a molecular weight of 385.37 g/mol. Its IUPAC name is N-[(3,5-difluorophenyl)methyl]-N'-[(4-methyl-5-phenyl-1,2-oxazol-3-yl)methyl]oxamide.
| Compound Name | N-[(3,5-difluorophenyl)methyl]-N'-[(4-methyl-5-phenyl-1,2-oxazol-3-yl)methyl]oxamide |
|---|---|
| PubChem CID | 167823701 |
| Molecular Formula | C20H17F2N3O3 |
| Molecular Weight | 385.37 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | N-[(3,5-difluorophenyl)methyl]-N'-[(4-methyl-5-phenyl-1,2-oxazol-3-yl)methyl]oxamide |
| SMILES | Cc1c(CNC(=O)C(=O)NCc2cc(F)cc(F)c2)noc1-c1ccccc1 |
| InChI | InChI=1S/C20H17F2N3O3/c1-12-17(25-28-18(12)14-5-3-2-4-6-14)11-24-20(27)19(26)23-10-13-7-15(21)9-16(22)8-13/h2-9H,10-11H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | YULOHZKVGIXATM-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|