C21H28FNO3Si — CID 68910061
[3-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-5-fluorophenyl]methylcarbamic acid (PubChem CID 68910061) has the molecular formula C21H28FNO3Si and a molecular weight of 389.54 g/mol. Its IUPAC name is [3-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-5-fluorophenyl]methylcarbamic acid.
| Compound Name | [3-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-5-fluorophenyl]methylcarbamic acid |
|---|---|
| PubChem CID | 68910061 |
| Molecular Formula | C21H28FNO3Si |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | [3-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-5-fluorophenyl]methylcarbamic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCc1cccc(-c2cc(F)cc(CNC(=O)O)c2)c1 |
| InChI | InChI=1S/C21H28FNO3Si/c1-21(2,3)27(4,5)26-14-15-7-6-8-17(9-15)18-10-16(11-19(22)12-18)13-23-20(24)25/h6-12,23H,13-14H2,1-5H3,(H,24,25) |
| InChIKey | IHQUXSBJONFWML-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|