C20H28FN3O2Si — CID 71232258
6-[[tert-butyl(dimethyl)silyl]oxymethyl]-N-[(3-fluorophenyl)methyl]-2-methylpyrimidine-4-carboxamide (PubChem CID 71232258) has the molecular formula C20H28FN3O2Si and a molecular weight of 389.55 g/mol. Its IUPAC name is 6-[[tert-butyl(dimethyl)silyl]oxymethyl]-N-[(3-fluorophenyl)methyl]-2-methylpyrimidine-4-carboxamide.
| Compound Name | 6-[[tert-butyl(dimethyl)silyl]oxymethyl]-N-[(3-fluorophenyl)methyl]-2-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 71232258 |
| Molecular Formula | C20H28FN3O2Si |
| Molecular Weight | 389.55 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 6-[[tert-butyl(dimethyl)silyl]oxymethyl]-N-[(3-fluorophenyl)methyl]-2-methylpyrimidine-4-carboxamide |
| SMILES | Cc1nc(CO[Si](C)(C)C(C)(C)C)cc(C(=O)NCc2cccc(F)c2)n1 |
| InChI | InChI=1S/C20H28FN3O2Si/c1-14-23-17(13-26-27(5,6)20(2,3)4)11-18(24-14)19(25)22-12-15-8-7-9-16(21)10-15/h7-11H,12-13H2,1-6H3,(H,22,25) |
| InChIKey | ZPKQOXIOTVZGBF-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.55 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|