C22H31NO4Si — CID 68909307
[3-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-5-methoxyphenyl]methylcarbamic acid (PubChem CID 68909307) has the molecular formula C22H31NO4Si and a molecular weight of 401.58 g/mol. Its IUPAC name is [3-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-5-methoxyphenyl]methylcarbamic acid.
| Compound Name | [3-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-5-methoxyphenyl]methylcarbamic acid |
|---|---|
| PubChem CID | 68909307 |
| Molecular Formula | C22H31NO4Si |
| Molecular Weight | 401.58 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | [3-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-5-methoxyphenyl]methylcarbamic acid |
| SMILES | COc1cc(CNC(=O)O)cc(-c2cccc(CO[Si](C)(C)C(C)(C)C)c2)c1 |
| InChI | InChI=1S/C22H31NO4Si/c1-22(2,3)28(5,6)27-15-16-8-7-9-18(10-16)19-11-17(14-23-21(24)25)12-20(13-19)26-4/h7-13,23H,14-15H2,1-6H3,(H,24,25) |
| InChIKey | XSFOSLUXWSUKCB-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.58 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|