C23H32N2O3Si — CID 68907182
[3-cyano-5-[3-[[dimethyl(propan-2-yl)silyl]oxymethyl]phenyl]phenyl]methylcarbamic acid;ethane (PubChem CID 68907182) has the molecular formula C23H32N2O3Si and a molecular weight of 412.61 g/mol. Its IUPAC name is [3-cyano-5-[3-[[dimethyl(propan-2-yl)silyl]oxymethyl]phenyl]phenyl]methylcarbamic acid;ethane.
| Compound Name | [3-cyano-5-[3-[[dimethyl(propan-2-yl)silyl]oxymethyl]phenyl]phenyl]methylcarbamic acid;ethane |
|---|---|
| PubChem CID | 68907182 |
| Molecular Formula | C23H32N2O3Si |
| Molecular Weight | 412.61 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | [3-cyano-5-[3-[[dimethyl(propan-2-yl)silyl]oxymethyl]phenyl]phenyl]methylcarbamic acid;ethane |
| SMILES | CC.CC(C)[Si](C)(C)OCc1cccc(-c2cc(C#N)cc(CNC(=O)O)c2)c1 |
| InChI | InChI=1S/C21H26N2O3Si.C2H6/c1-15(2)27(3,4)26-14-16-6-5-7-19(9-16)20-10-17(12-22)8-18(11-20)13-23-21(24)25;1-2/h5-11,15,23H,13-14H2,1-4H3,(H,24,25);1-2H3 |
| InChIKey | NQIOGKUOQTYYNF-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.61 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|