C24H21NO3 — CID 70842739
3-[4-[[3-(4-cyanophenyl)phenyl]methoxy]phenyl]butanoic acid (PubChem CID 70842739) has the molecular formula C24H21NO3 and a molecular weight of 371.44 g/mol. Its IUPAC name is 3-[4-[[3-(4-cyanophenyl)phenyl]methoxy]phenyl]butanoic acid.
| Compound Name | 3-[4-[[3-(4-cyanophenyl)phenyl]methoxy]phenyl]butanoic acid |
|---|---|
| PubChem CID | 70842739 |
| Molecular Formula | C24H21NO3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 3-[4-[[3-(4-cyanophenyl)phenyl]methoxy]phenyl]butanoic acid |
| SMILES | CC(CC(=O)O)c1ccc(OCc2cccc(-c3ccc(C#N)cc3)c2)cc1 |
| InChI | InChI=1S/C24H21NO3/c1-17(13-24(26)27)20-9-11-23(12-10-20)28-16-19-3-2-4-22(14-19)21-7-5-18(15-25)6-8-21/h2-12,14,17H,13,16H2,1H3,(H,26,27) |
| InChIKey | UILXUAMYVSLYAL-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |