C24H20F3NO4 — CID 173064196
4-hydroxyimino-3-[4-[[3-[4-(trifluoromethyl)phenyl]phenyl]methoxy]phenyl]butanoic acid (PubChem CID 173064196) has the molecular formula C24H20F3NO4 and a molecular weight of 443.42 g/mol. Its IUPAC name is 4-hydroxyimino-3-[4-[[3-[4-(trifluoromethyl)phenyl]phenyl]methoxy]phenyl]butanoic acid.
| Compound Name | 4-hydroxyimino-3-[4-[[3-[4-(trifluoromethyl)phenyl]phenyl]methoxy]phenyl]butanoic acid |
|---|---|
| PubChem CID | 173064196 |
| Molecular Formula | C24H20F3NO4 |
| Molecular Weight | 443.42 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 4-hydroxyimino-3-[4-[[3-[4-(trifluoromethyl)phenyl]phenyl]methoxy]phenyl]butanoic acid |
| SMILES | O=C(O)CC(C=NO)c1ccc(OCc2cccc(-c3ccc(C(F)(F)F)cc3)c2)cc1 |
| InChI | InChI=1S/C24H20F3NO4/c25-24(26,27)21-8-4-17(5-9-21)19-3-1-2-16(12-19)15-32-22-10-6-18(7-11-22)20(14-28-31)13-23(29)30/h1-12,14,20,31H,13,15H2,(H,29,30) |
| InChIKey | XXHGSGUCFNTPLI-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.42 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|