C26H23F3N2O5 — CID 59218543
methyl 4-(2-formylhydrazinyl)-4-oxo-3-[4-[[3-[4-(trifluoromethyl)phenyl]phenyl]methoxy]phenyl]butanoate (PubChem CID 59218543) has the molecular formula C26H23F3N2O5 and a molecular weight of 500.47 g/mol. Its IUPAC name is methyl 4-(2-formylhydrazinyl)-4-oxo-3-[4-[[3-[4-(trifluoromethyl)phenyl]phenyl]methoxy]phenyl]butanoate.
| Compound Name | methyl 4-(2-formylhydrazinyl)-4-oxo-3-[4-[[3-[4-(trifluoromethyl)phenyl]phenyl]methoxy]phenyl]butanoate |
|---|---|
| PubChem CID | 59218543 |
| Molecular Formula | C26H23F3N2O5 |
| Molecular Weight | 500.47 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | methyl 4-(2-formylhydrazinyl)-4-oxo-3-[4-[[3-[4-(trifluoromethyl)phenyl]phenyl]methoxy]phenyl]butanoate |
| SMILES | COC(=O)CC(C(=O)NNC=O)c1ccc(OCc2cccc(-c3ccc(C(F)(F)F)cc3)c2)cc1 |
| InChI | InChI=1S/C26H23F3N2O5/c1-35-24(33)14-23(25(34)31-30-16-32)19-7-11-22(12-8-19)36-15-17-3-2-4-20(13-17)18-5-9-21(10-6-18)26(27,28)29/h2-13,16,23H,14-15H2,1H3,(H,30,32)(H,31,34) |
| InChIKey | FMIPARNNMVUNIH-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.47 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|