C26H22F3NO4 — CID 162584447
(3S)-4-amino-6-oxo-3-[4-[[3-[4-(trifluoromethyl)phenyl]phenyl]methoxy]phenyl]hex-4-enoic acid (PubChem CID 162584447) has the molecular formula C26H22F3NO4 and a molecular weight of 469.46 g/mol. Its IUPAC name is (3S)-4-amino-6-oxo-3-[4-[[3-[4-(trifluoromethyl)phenyl]phenyl]methoxy]phenyl]hex-4-enoic acid.
| Compound Name | (3S)-4-amino-6-oxo-3-[4-[[3-[4-(trifluoromethyl)phenyl]phenyl]methoxy]phenyl]hex-4-enoic acid |
|---|---|
| PubChem CID | 162584447 |
| Molecular Formula | C26H22F3NO4 |
| Molecular Weight | 469.46 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | (3S)-4-amino-6-oxo-3-[4-[[3-[4-(trifluoromethyl)phenyl]phenyl]methoxy]phenyl]hex-4-enoic acid |
| SMILES | NC(=CC=O)[C@@H](CC(=O)O)c1ccc(OCc2cccc(-c3ccc(C(F)(F)F)cc3)c2)cc1 |
| InChI | InChI=1S/C26H22F3NO4/c27-26(28,29)21-8-4-18(5-9-21)20-3-1-2-17(14-20)16-34-22-10-6-19(7-11-22)23(15-25(32)33)24(30)12-13-31/h1-14,23H,15-16,30H2,(H,32,33)/t23-/m0/s1 |
| InChIKey | LGIFODCBYCMGPQ-QHCPKHFHSA-N |
| XLogP | 5.55 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.46 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|