C26H22F3NO6S — CID 162584452
CID 162584452 (PubChem CID 162584452) has the molecular formula C26H22F3NO6S and a molecular weight of 533.52 g/mol.
| Compound Name | CID 162584452 |
|---|---|
| PubChem CID | 162584452 |
| Molecular Formula | C26H22F3NO6S |
| Molecular Weight | 533.52 g/mol |
| Exact Mass | 533.11 |
| IUPAC Name | — |
| SMILES | NC(=CC=O)[C@@H](CC(=O)[O-])c1ccc(OCc2cccc([S+](=O)(O)c3ccc(C(F)(F)F)cc3)c2)cc1 |
| InChI | InChI=1S/C26H22F3NO6S/c27-26(28,29)19-6-10-21(11-7-19)37(34,35)22-3-1-2-17(14-22)16-36-20-8-4-18(5-9-20)23(15-25(32)33)24(30)12-13-31/h1-14,23H,15-16H2,(H3-,30,31,32,33,34,35)/t23-/m0/s1 |
| InChIKey | ZHAFSGDVFCFUSC-QHCPKHFHSA-N |
| XLogP | 3.94 |
| TPSA | 129.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.52 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|