C28H29FO5 — CID 59132605
4-O-tert-butyl 1-O-methyl 2-[4-[[3-(4-fluorophenyl)phenyl]methoxy]phenyl]butanedioate (PubChem CID 59132605) has the molecular formula C28H29FO5 and a molecular weight of 464.53 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-methyl 2-[4-[[3-(4-fluorophenyl)phenyl]methoxy]phenyl]butanedioate.
| Compound Name | 4-O-tert-butyl 1-O-methyl 2-[4-[[3-(4-fluorophenyl)phenyl]methoxy]phenyl]butanedioate |
|---|---|
| PubChem CID | 59132605 |
| Molecular Formula | C28H29FO5 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 4-O-tert-butyl 1-O-methyl 2-[4-[[3-(4-fluorophenyl)phenyl]methoxy]phenyl]butanedioate |
| SMILES | COC(=O)C(CC(=O)OC(C)(C)C)c1ccc(OCc2cccc(-c3ccc(F)cc3)c2)cc1 |
| InChI | InChI=1S/C28H29FO5/c1-28(2,3)34-26(30)17-25(27(31)32-4)21-10-14-24(15-11-21)33-18-19-6-5-7-22(16-19)20-8-12-23(29)13-9-20/h5-16,25H,17-18H2,1-4H3 |
| InChIKey | INCPIZYUFHVMHK-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |