C21H28OSi — CID 86054113
tert-butyl-dimethyl-[[3-(1-phenylethenyl)phenyl]methoxy]silane (PubChem CID 86054113) has the molecular formula C21H28OSi and a molecular weight of 324.54 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[3-(1-phenylethenyl)phenyl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[3-(1-phenylethenyl)phenyl]methoxy]silane |
|---|---|
| PubChem CID | 86054113 |
| Molecular Formula | C21H28OSi |
| Molecular Weight | 324.54 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | tert-butyl-dimethyl-[[3-(1-phenylethenyl)phenyl]methoxy]silane |
| SMILES | C=C(c1ccccc1)c1cccc(CO[Si](C)(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C21H28OSi/c1-17(19-12-8-7-9-13-19)20-14-10-11-18(15-20)16-22-23(5,6)21(2,3)4/h7-15H,1,16H2,2-6H3 |
| InChIKey | MYFKFDIWTKIUDJ-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.54 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|