C28H47BrO3Si2 — CID 159353997
[3-(bromomethyl)phenyl]methoxy-tert-butyl-dimethylsilane;[3-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]methanol (PubChem CID 159353997) has the molecular formula C28H47BrO3Si2 and a molecular weight of 567.76 g/mol. Its IUPAC name is [3-(bromomethyl)phenyl]methoxy-tert-butyl-dimethylsilane;[3-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]methanol.
| Compound Name | [3-(bromomethyl)phenyl]methoxy-tert-butyl-dimethylsilane;[3-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]methanol |
|---|---|
| PubChem CID | 159353997 |
| Molecular Formula | C28H47BrO3Si2 |
| Molecular Weight | 567.76 g/mol |
| Exact Mass | 566.22 |
| IUPAC Name | [3-(bromomethyl)phenyl]methoxy-tert-butyl-dimethylsilane;[3-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]methanol |
| SMILES | CC(C)(C)[Si](C)(C)OCc1cccc(CBr)c1.CC(C)(C)[Si](C)(C)OCc1cccc(CO)c1 |
| InChI | InChI=1S/C14H23BrOSi.C14H24O2Si/c2*1-14(2,3)17(4,5)16-11-13-8-6-7-12(9-13)10-15/h6-9H,10-11H2,1-5H3;6-9,15H,10-11H2,1-5H3 |
| InChIKey | LHRKOZPJEAWVLB-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.76 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|