C18H26N2O2Si — CID 152503696
[3-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrimidin-2-yl]phenyl]methanol (PubChem CID 152503696) has the molecular formula C18H26N2O2Si and a molecular weight of 330.50 g/mol. Its IUPAC name is [3-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrimidin-2-yl]phenyl]methanol.
| Compound Name | [3-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrimidin-2-yl]phenyl]methanol |
|---|---|
| PubChem CID | 152503696 |
| Molecular Formula | C18H26N2O2Si |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | [3-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrimidin-2-yl]phenyl]methanol |
| SMILES | CC(C)(C)[Si](C)(C)OCc1ccnc(-c2cccc(CO)c2)n1 |
| InChI | InChI=1S/C18H26N2O2Si/c1-18(2,3)23(4,5)22-13-16-9-10-19-17(20-16)15-8-6-7-14(11-15)12-21/h6-11,21H,12-13H2,1-5H3 |
| InChIKey | YDZVRERCUFFDLH-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|