C23H21F2N3O3 — CID 166330645
N'-[[1-(2,4-difluorophenyl)cyclopropyl]methyl]-N-[(4-methyl-5-phenyl-1,2-oxazol-3-yl)methyl]oxamide (PubChem CID 166330645) has the molecular formula C23H21F2N3O3 and a molecular weight of 425.44 g/mol. Its IUPAC name is N'-[[1-(2,4-difluorophenyl)cyclopropyl]methyl]-N-[(4-methyl-5-phenyl-1,2-oxazol-3-yl)methyl]oxamide.
| Compound Name | N'-[[1-(2,4-difluorophenyl)cyclopropyl]methyl]-N-[(4-methyl-5-phenyl-1,2-oxazol-3-yl)methyl]oxamide |
|---|---|
| PubChem CID | 166330645 |
| Molecular Formula | C23H21F2N3O3 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | N'-[[1-(2,4-difluorophenyl)cyclopropyl]methyl]-N-[(4-methyl-5-phenyl-1,2-oxazol-3-yl)methyl]oxamide |
| SMILES | Cc1c(CNC(=O)C(=O)NCC2(c3ccc(F)cc3F)CC2)noc1-c1ccccc1 |
| InChI | InChI=1S/C23H21F2N3O3/c1-14-19(28-31-20(14)15-5-3-2-4-6-15)12-26-21(29)22(30)27-13-23(9-10-23)17-8-7-16(24)11-18(17)25/h2-8,11H,9-10,12-13H2,1H3,(H,26,29)(H,27,30) |
| InChIKey | SQUDCXTYSXINOX-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|