C16H19F2NO3 — CID 122066556
3-[[1-(2,4-difluorophenyl)cyclopentyl]methylamino]-2-methyl-3-oxopropanoic acid (PubChem CID 122066556) has the molecular formula C16H19F2NO3 and a molecular weight of 311.33 g/mol. Its IUPAC name is 3-[[1-(2,4-difluorophenyl)cyclopentyl]methylamino]-2-methyl-3-oxopropanoic acid.
| Compound Name | 3-[[1-(2,4-difluorophenyl)cyclopentyl]methylamino]-2-methyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 122066556 |
| Molecular Formula | C16H19F2NO3 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 3-[[1-(2,4-difluorophenyl)cyclopentyl]methylamino]-2-methyl-3-oxopropanoic acid |
| SMILES | CC(C(=O)O)C(=O)NCC1(c2ccc(F)cc2F)CCCC1 |
| InChI | InChI=1S/C16H19F2NO3/c1-10(15(21)22)14(20)19-9-16(6-2-3-7-16)12-5-4-11(17)8-13(12)18/h4-5,8,10H,2-3,6-7,9H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | NFYNZZMTWIQNRP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|